You can:
Name | CHEMBL50188 |
---|---|
Molecular formula | C25H36N2O4 |
IUPAC name | 8-[3-[(5-methoxy-3,4-dihydro-2H-chromen-3-yl)-propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione |
Molecular weight | 428.573 |
Hydrogen bond acceptor | 5 |
Hydrogen bond donor | 0 |
XlogP | 4.2 |
Synonyms | CHEMBL27650 BDBM50036856 8-[3-[[(5-Methoxy-3,4-dihydro-2H-1-benzopyran)-3-yl]propylamino]propyl]-8-azaspiro[4.5]decane-7,9-dione 8-{3-[(5-Methoxy-chroman-3-yl)-propyl-amino]-propyl}-8-aza-spiro[4.5]decane-7,9-dione; compound with oxalic acid |
Inchi Key | AGKVXTQIBHAKGE-UHFFFAOYSA-N |
Inchi ID | InChI=1S/C25H36N2O4/c1-3-12-26(19-15-20-21(30-2)8-6-9-22(20)31-18-19)13-7-14-27-23(28)16-25(17-24(27)29)10-4-5-11-25/h6,8-9,19H,3-5,7,10-18H2,1-2H3 |
PubChem CID | 10252000 |
ChEMBL | CHEMBL27650 |
IUPHAR | N/A |
BindingDB | 50036856 |
DrugBank | N/A |
Structure | |
Lipinski's druglikeness | This ligand satisfies Lipinski's rule of five. |
You can:
GLASS ID | Name | UniProt | Gene | Species | Length |
---|---|---|---|---|---|
4973 | 5-hydroxytryptamine receptor 1A | P19327 | Htr1a | Rattus norvegicus (Rat) | 422 |
4976 | 5-hydroxytryptamine receptor 1B | P28564 | Htr1b | Rattus norvegicus (Rat) | 386 |
4971 | 5-hydroxytryptamine receptor 2A | Q75Z89 | HTR2A | Bos taurus (Bovine) | 470 |
4975 | Alpha-1A adrenergic receptor | P18130 | ADRA1A | Bos taurus (Bovine) | 466 |
4974 | Alpha-2A adrenergic receptor | Q28838 | ADRA2A | Bos taurus (Bovine) | 452 |
4972 | D(1A) dopamine receptor | Q95136 | DRD1 | Bos taurus (Bovine) | 446 |
4977 | D(2) dopamine receptor | P20288 | DRD2 | Bos taurus (Bovine) | 444 |
zhanglabzhanggroup.org | (734) 647-1549 | 100 Washtenaw Avenue, Ann Arbor, MI 48109-2218